| id | C00027811 |
|---|---|
| Name | Aeruginosin 103-A |
| CAS RN | 211428-63-6 |
| Standard InChI | InChI=1S/C35H48N6O8/c1-2-49-34-26(4-3-15-40(34)35(36)37)38-31(46)29-18-22-9-14-25(44)19-28(22)41(29)33(48)27(16-20-5-10-23(42)11-6-20)39-32(47)30(45)17-21-7-12-24(43)13-8-21/h5-8,10-13,22,25-30,34,42-45H,2-4,9,14-19H2,1H3,(H3,36,37)(H,38,46)(H,39,47)/t22?,25?,26-,27+,28?,29?,30+,34+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C35H48N6O8/c1-2-49-34-26(4-3-15-40(34)35(36)37)38-31(46)29-18-22-9-14-25(44)19-28(22)41(29)33(48)27(16-20-5-10-23(42)11-6-20)39-32(47)30(45)17-21-7-12-24(43)13-8-21/h5-8,10-13,22,25-30,34,42-45H,2-4,9,14-19H2,1H3,(H3,36,37)(H,38,46)(H,39,47) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3498 |
| By standard InChI | CHEMBL503490 |
|---|---|
| By standard InChI Main Layer | CHEMBL503490 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Microcystis viridis | 44822 | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00747 | Plasminogen | S1A | CHEMBL503490 |
CHEMBL1004237
(1)
|
1 / 2 |
| P00734 | Prothrombin | S1A | CHEMBL503490 |
CHEMBL1004235
(1)
|
4 / 2 |