| id | C00027976 |
|---|---|
| Name | BU-4664L / ECO 4601 / ECO 04601 / Diazepinomicin |
| CAS RN | 733035-26-2 |
| Standard InChI | InChI=1S/C28H34N2O4/c1-18(2)8-5-9-19(3)10-6-11-20(4)14-15-30-23-16-21(31)17-25(33)27(23)29-26-22(28(30)34)12-7-13-24(26)32/h7-8,10,12-14,16-17,29,31-33H,5-6,9,11,15H2,1-4H3/b19-10+,20-14+ |
| Standard InChI (Main Layer) | InChI=1S/C28H34N2O4/c1-18(2)8-5-9-19(3)10-6-11-20(4)14-15-30-23-16-21(31)17-25(33)27(23)29-26-22(28(30)34)12-7-13-24(26)32/h7-8,10,12-14,16-17,29,31-33H,5-6,9,11,15H2,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 6362 |
| By standard InChI | CHEMBL550961 |
|---|---|
| By standard InChI Main Layer | CHEMBL550961 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Micromonosporaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Micromonospora sp. M990-6 | 1873 | Micromonosporaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P14780 | Matrix metalloproteinase-9 | M10A | CHEMBL550961 |
CHEMBL1072412
(1)
|
2 / 2 |
| P08253 | 72 kDa type IV collagenase | M10A | CHEMBL550961 |
CHEMBL1072411
(1)
|
1 / 3 |