| id | C00028032 |
|---|---|
| Name | Cerpegin |
| CAS RN | 129748-28-3 |
| Standard InChI | InChI=1S/C10H11NO3/c1-10(2)6-4-5-11(3)8(12)7(6)9(13)14-10/h4-5H,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C10H11NO3/c1-10(2)6-4-5-11(3)8(12)7(6)9(13)14-10/h4-5H,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7145 |
| By standard InChI | CHEMBL1971143 |
|---|---|
| By standard InChI Main Layer | CHEMBL1971143 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Apocynaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Ceropegia juncea | 185234 | Apocynaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P07858 | Cathepsin B | C1A | CHEMBL1971143 |
CHEMBL2037868
(1)
|
0 / 1 |