| id | C00028083 |
|---|---|
| Name | Complanadine A |
| CAS RN | 317802-77-0 |
| Standard InChI | InChI=1S/C32H42N4/c1-19-12-22-15-30-26(31(16-19)24(22)5-3-9-34-31)7-8-28(36-30)23-13-27-29(33-18-23)14-21-11-20(2)17-32(27)25(21)6-4-10-35-32/h7-8,13,18-22,24-25,34-35H,3-6,9-12,14-17H2,1-2H3/t19-,20-,21+,22+,24-,25-,31-,32-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C32H42N4/c1-19-12-22-15-30-26(31(16-19)24(22)5-3-9-34-31)7-8-28(36-30)23-13-27-29(33-18-23)14-21-11-20(2)17-32(27)25(21)6-4-10-35-32/h7-8,13,18-22,24-25,34-35H,3-6,9-12,14-17H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 6726 |
| By standard InChI | CHEMBL1644379 |
|---|---|
| By standard InChI Main Layer | CHEMBL1644379 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Embryophyta | 1 |
| family name | count |
|---|---|
| Lycopodiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Lycopodium complanatum | 34168 | Lycopodiaceae | Embryophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P01138 | Beta-nerve growth factor | Unclassified protein | CHEMBL1644379 |
CHEMBL1648454
(1)
CHEMBL1648455
(1)
|
1 / 1 |