| id | C00028145 |
|---|---|
| Name | Dehydroradiosumin |
| CAS RN | 208925-57-9 |
| Standard InChI | InChI=1S/C22H30N4O5/c1-13(27)24-18-9-5-16(6-10-18)12-20(22(30)31)26-21(29)19(25-14(2)28)11-15-3-7-17(23)8-4-15/h3,5,7,9,11-12,17-20H,4,6,8,10,23H2,1-2H3,(H,24,27)(H,25,28)(H,26,29)(H,30,31)/b15-11-,16-12-/t17-,18-,19-,20-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H30N4O5/c1-13(27)24-18-9-5-16(6-10-18)12-20(22(30)31)26-21(29)19(25-14(2)28)11-15-3-7-17(23)8-4-15/h3,5,7,9,11-12,17-20H,4,6,8,10,23H2,1-2H3,(H,24,27)(H,25,28)(H,26,29)(H,30,31) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3758 |
| By standard InChI | CHEMBL476077 |
|---|---|
| By standard InChI Main Layer | CHEMBL476077 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Nostocaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Anabaena cylindrica | 1165 | Nostocaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00747 | Plasminogen | S1A | CHEMBL476077 |
CHEMBL1019351
(1)
|
1 / 2 |
| P00734 | Prothrombin | S1A | CHEMBL476077 |
CHEMBL1019352
(1)
|
4 / 2 |