| id | C00028534 | 
|---|---|
| Name | Lyngbyastatin 2 | 
| CAS RN | 252000-07-0 | 
| Standard InChI | InChI=1S/C56H94N6O13/c1-18-35(7)49-53(68)60(15)47(33(3)4)52(67)57(12)43(32-72-16)51(66)61-29-21-24-41(61)50(65)59(14)48(34(5)6)54(69)62-30-22-25-42(62)56(71)75-40(19-2)23-20-26-44(63)38(10)55(70)74-39(11)36(8)27-28-37(9)45(73-17)31-46(64)58(49)13/h28,31,33-36,38-44,47-49,63H,18-27,29-30,32H2,1-17H3/b37-28+,45-31+/t35?,36-,38+,39+,40+,41-,42-,43-,44+,47-,48+,49?/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C56H94N6O13/c1-18-35(7)49-53(68)60(15)47(33(3)4)52(67)57(12)43(32-72-16)51(66)61-29-21-24-41(61)50(65)59(14)48(34(5)6)54(69)62-30-22-25-42(62)56(71)75-40(19-2)23-20-26-44(63)38(10)55(70)74-39(11)36(8)27-28-37(9)45(73-17)31-46(64)58(49)13/h28,31,33-36,38-44,47-49,63H,18-27,29-30,32H2,1-17H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4309 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL507890 CHEMBL1873644 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Lyngbya majuscula | 158786 | Bacteria | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL1873644 | CHEMBL2114784
                        (1) | 1 / 1 | 
| P11387 | DNA topoisomerase 1 | Isomerase | CHEMBL507890 | CHEMBL968334
                        (1) | 0 / 0 | 
| O60755 | Galanin receptor type 3 | Galanin receptor | CHEMBL1873644 | CHEMBL2354227
                        (1) | 0 / 0 | 
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL1873644 | CHEMBL1794584
                        (1) | 2 / 0 | 
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL1873644 | CHEMBL2354311
                        (1) | 1 / 0 | 
| Q06710 | Paired box protein Pax-8 | Unclassified protein | CHEMBL1873644 | CHEMBL2354301
                        (1) | 1 / 2 |