| id | C00028546 |
|---|---|
| Name | Maistemonine / Protostemotinine |
| CAS RN | 137031-44-8 |
| Standard InChI | InChI=1S/C23H29NO6/c1-12-11-17(29-20(12)26)16-8-9-22-15(7-5-6-10-24(16)22)13(2)18(25)23(22)19(28-4)14(3)21(27)30-23/h12,16-17H,5-11H2,1-4H3/t12-,16-,17-,22+,23+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C23H29NO6/c1-12-11-17(29-20(12)26)16-8-9-22-15(7-5-6-10-24(16)22)13(2)18(25)23(22)19(28-4)14(3)21(27)30-23/h12,16-17H,5-11H2,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2562 |
| By standard InChI | CHEMBL1394235 |
|---|---|
| By standard InChI Main Layer | CHEMBL1394235 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 2 |
| family name | count |
|---|---|
| Stemonaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Stemona japonica | 85282 | Stemonaceae | Liliopsida | Viridiplantae |
| Stemona mairei | 448267 | Stemonaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL1394235 |
CHEMBL1794584
(1)
|
2 / 0 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL1394235 |
CHEMBL1794401
(1)
|
0 / 0 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL1394235 |
CHEMBL1738588
(1)
|
0 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #114500 | Colorectal cancer; crc |
P84022
|
| #613795 | Loeys-dietz syndrome, type 3; lds3 |
P84022
|