| id | C00002860 |
|---|---|
| Name | Rapanone |
| CAS RN | 573-40-0 |
| Standard InChI | InChI=1S/C19H30O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18(22)16(20)14-17(21)19(15)23/h14,20,23H,2-13H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C19H30O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18(22)16(20)14-17(21)19(15)23/h14,20,23H,2-13H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 558 |
| By standard InChI | CHEMBL462801 |
|---|---|
| By standard InChI Main Layer | CHEMBL462801 |
| By LinkDB | C10399 |
|---|
| By CAS RN | C054611 |
|---|
| family name | count |
|---|---|
| Primulaceae | 5 |
| Connaraceae | 2 |
| Oxalidaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL462801 |
CHEMBL980220
(1)
|
0 / 0 |
| P00734 | Prothrombin | S1A | CHEMBL462801 |
CHEMBL976587
(1)
|
4 / 2 |