id | C00002860 |
---|---|
Name | Rapanone |
CAS RN | 573-40-0 |
Standard InChI | InChI=1S/C19H30O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18(22)16(20)14-17(21)19(15)23/h14,20,23H,2-13H2,1H3 |
Standard InChI (Main Layer) | InChI=1S/C19H30O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18(22)16(20)14-17(21)19(15)23/h14,20,23H,2-13H2,1H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 558 |
By standard InChI | CHEMBL462801 |
---|---|
By standard InChI Main Layer | CHEMBL462801 |
By LinkDB | C10399 |
---|
By CAS RN | C054611 |
---|
family name | count |
---|---|
Primulaceae | 5 |
Connaraceae | 2 |
Oxalidaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL462801 |
CHEMBL980220
(1)
|
0 / 0 |
P00734 | Prothrombin | S1A | CHEMBL462801 |
CHEMBL976587
(1)
|
4 / 2 |