| id | C00028645 |
|---|---|
| Name | Nangustine |
| CAS RN | 474794-31-5 |
| Standard InChI | InChI=1S/C16H17NO4/c18-12-3-1-9-10-5-17(14(9)15(12)19)6-11-8(10)2-4-13-16(11)21-7-20-13/h1-2,4,10,12,14-15,18-19H,3,5-7H2/t10-,12-,14+,15+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C16H17NO4/c18-12-3-1-9-10-5-17(14(9)15(12)19)6-11-8(10)2-4-13-16(11)21-7-20-13/h1-2,4,10,12,14-15,18-19H,3,5-7H2 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 1156 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB | C12185 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Amaryllidaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Narcissus angustifolius subsp. transcanpathicus | 4697 | Amaryllidaceae | Liliopsida | Viridiplantae |