| id | C00028778 |
|---|---|
| Name | Oscillamide Y |
| CAS RN | 168482-80-2 |
| Standard InChI | InChI=1S/C45H59N7O10/c1-5-27(2)38-42(58)47-35(23-18-29-14-19-32(53)20-15-29)43(59)52(4)28(3)39(55)48-36(25-30-11-7-6-8-12-30)40(56)46-24-10-9-13-34(41(57)51-38)49-45(62)50-37(44(60)61)26-31-16-21-33(54)22-17-31/h6-8,11-12,14-17,19-22,27-28,34-38,53-54H,5,9-10,13,18,23-26H2,1-4H3,(H,46,56)(H,47,58)(H,48,55)(H,51,57)(H,60,61)(H2,49,50,62)/t27-,28+,34-,35+,36+,37+,38?/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C45H59N7O10/c1-5-27(2)38-42(58)47-35(23-18-29-14-19-32(53)20-15-29)43(59)52(4)28(3)39(55)48-36(25-30-11-7-6-8-12-30)40(56)46-24-10-9-13-34(41(57)51-38)49-45(62)50-37(44(60)61)26-31-16-21-33(54)22-17-31/h6-8,11-12,14-17,19-22,27-28,34-38,53-54H,5,9-10,13,18,23-26H2,1-4H3,(H,46,56)(H,47,58)(H,48,55)(H,51,57)(H,60,61)(H2,49,50,62) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 445 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL446236 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Oscillatoria agardhii | 1160 | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P51452 | Dual specificity protein phosphatase 3 | Ser_Thr_Tyr | CHEMBL446236 |
CHEMBL948721
(1)
|
0 / 0 |
| P30305 | M-phase inducer phosphatase 2 | Ser_Thr_Tyr | CHEMBL446236 |
CHEMBL948722
(1)
|
0 / 0 |