| id | C00002894 |
|---|---|
| Name | Phyllodulcin |
| CAS RN | 21499-23-0 |
| Standard InChI | InChI=1S/C16H14O5/c1-20-13-6-5-9(7-12(13)18)14-8-10-3-2-4-11(17)15(10)16(19)21-14/h2-7,14,17-18H,8H2,1H3/t14-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C16H14O5/c1-20-13-6-5-9(7-12(13)18)14-8-10-3-2-4-11(17)15(10)16(19)21-14/h2-7,14,17-18H,8H2,1H3 |
| Phytochemical cluster | No. 29 |
|---|---|
| KCF-S cluster | No. 1122 |
| By standard InChI | CHEMBL303483 |
|---|---|
| By standard InChI Main Layer | CHEMBL303483 |
| By LinkDB | C10274 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Hydrangeaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Hydrangea macrophylla var thunbergii | 23109 | Hydrangeaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL303483 |
CHEMBL2114788
(1)
|
0 / 0 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL303483 |
CHEMBL1794401
(1)
|
0 / 0 |
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL303483 |
CHEMBL2114908
(1)
|
0 / 0 |
| Q13148 | TAR DNA-binding protein 43 | Unclassified protein | CHEMBL303483 |
CHEMBL2354287
(1)
|
1 / 1 |