| id | C00028969 |
|---|---|
| Name | Sarcovagine B |
| CAS RN | 192385-46-9 |
| Standard InChI | InChI=1S/C30H50N2O4/c1-9-17(2)28(35)31-26-25(34)16-30(6)23-14-15-29(5)21(18(3)32(7)8)12-13-22(29)20(23)10-11-24(30)27(26)36-19(4)33/h9,18,20-27,34H,10-16H2,1-8H3,(H,31,35)/b17-9+/t18-,20-,21+,22-,23-,24-,25+,26-,27+,29+,30+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C30H50N2O4/c1-9-17(2)28(35)31-26-25(34)16-30(6)23-14-15-29(5)21(18(3)32(7)8)12-13-22(29)20(23)10-11-24(30)27(26)36-19(4)33/h9,18,20-27,34H,10-16H2,1-8H3,(H,31,35) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1684 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL421920 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Buxaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Sarcococca vagans Stapt. | 108422 | Buxaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P06276 | Cholinesterase | Hydrolase | CHEMBL421920 |
CHEMBL651728
(1)
CHEMBL654392
(1)
|
0 / 0 |
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL421920 |
CHEMBL641237
(1)
|
1 / 0 |