| id | C00028971 | 
|---|---|
| Name | Sarcovagine D | 
| CAS RN | 192385-49-2 | 
| Standard InChI | InChI=1S/C28H44N2O2/c1-8-17(2)26(32)29-24-14-16-28(5)22-13-15-27(4)20(18(3)30(6)7)11-12-21(27)19(22)9-10-23(28)25(24)31/h8,14,18-23H,9-13,15-16H2,1-7H3,(H,29,32)/b17-8+/t18-,19-,20+,21-,22-,23-,27+,28+/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C28H44N2O2/c1-8-17(2)26(32)29-24-14-16-28(5)22-13-15-27(4)20(18(3)30(6)7)11-12-21(27)19(22)9-10-23(28)25(24)31/h8,14,18-23H,9-13,15-16H2,1-7H3,(H,29,32) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3577 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL136135 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| eudicotyledons | 1 | 
| family name | count | 
|---|---|
| Buxaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Sarcococca vagans Stapt. | 108422 | Buxaceae | eudicotyledons | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL136135 | CHEMBL641237
                        (1) | 1 / 0 |