| id | C00028971 |
|---|---|
| Name | Sarcovagine D |
| CAS RN | 192385-49-2 |
| Standard InChI | InChI=1S/C28H44N2O2/c1-8-17(2)26(32)29-24-14-16-28(5)22-13-15-27(4)20(18(3)30(6)7)11-12-21(27)19(22)9-10-23(28)25(24)31/h8,14,18-23H,9-13,15-16H2,1-7H3,(H,29,32)/b17-8+/t18-,19-,20+,21-,22-,23-,27+,28+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C28H44N2O2/c1-8-17(2)26(32)29-24-14-16-28(5)22-13-15-27(4)20(18(3)30(6)7)11-12-21(27)19(22)9-10-23(28)25(24)31/h8,14,18-23H,9-13,15-16H2,1-7H3,(H,29,32) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3577 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL136135 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Buxaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Sarcococca vagans Stapt. | 108422 | Buxaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL136135 |
CHEMBL641237
(1)
|
1 / 0 |