| id | C00029007 |
|---|---|
| Name | Shermilamine B / Debromoshermilamine A |
| CAS RN | 122271-41-4 |
| Standard InChI | InChI=1S/C21H18N4O2S/c1-11(26)22-8-7-14-18-17-13(12-4-2-3-5-15(12)24-18)6-9-23-19(17)20-21(14)28-10-16(27)25-20/h2-6,9,24H,7-8,10H2,1H3,(H,22,26)(H,25,27) |
| Standard InChI (Main Layer) | InChI=1S/C21H18N4O2S/c1-11(26)22-8-7-14-18-17-13(12-4-2-3-5-15(12)24-18)6-9-23-19(17)20-21(14)28-10-16(27)25-20/h2-6,9,24H,7-8,10H2,1H3,(H,22,26)(H,25,27) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 743 |
| By standard InChI | CHEMBL127873 |
|---|---|
| By standard InChI Main Layer | CHEMBL127873 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Polycitoridae | 1 |
| Didemnidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Chelynotus semperi | ||||
| Cystodytes sp. | 260823 | Polycitoridae | Metazoa | |
| Trididemnum sp. | 322846 | Didemnidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL127873 |
CHEMBL813448
(1)
|
0 / 0 |
| Q02880 | DNA topoisomerase 2-beta | Isomerase | CHEMBL127873 |
CHEMBL813448
(1)
|
0 / 0 |