| id | C00029454 |
|---|---|
| Name | 2-Deoxy-epi-inositol |
| CAS RN | 19776-68-2 |
| Standard InChI | InChI=1S/C6H12O5/c7-2-1-3(8)5(10)6(11)4(2)9/h2-11H,1H2/t2-,3+,4-,5-,6-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C6H12O5/c7-2-1-3(8)5(10)6(11)4(2)9/h2-11H,1H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 795 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL34244 CHEMBL37104 CHEMBL354060 CHEMBL467977 CHEMBL1950778 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 2 |
| family name | count |
|---|---|
| Viscaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Viscum articulactum | 3971 | Viscaceae | eudicotyledons | Viridiplantae |
| Viscum coloratum | 3971 | Viscaceae | eudicotyledons | Viridiplantae |