| id | C00029620 |
|---|---|
| Name | Acerogenin B |
| CAS RN | 74174-17-7 |
| Standard InChI | InChI=1S/C19H22O3/c20-16-4-2-1-3-14-6-10-17(11-7-14)22-19-13-15(5-9-16)8-12-18(19)21/h6-8,10-13,16,20-21H,1-5,9H2 |
| Standard InChI (Main Layer) | InChI=1S/C19H22O3/c20-16-4-2-1-3-14-6-10-17(11-7-14)22-19-13-15(5-9-16)8-12-18(19)21/h6-8,10-13,16,20-21H,1-5,9H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1677 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL462920 CHEMBL1778760 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Acer nikoense | 171213 | Aceraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P13866 | Sodium/glucose cotransporter 1 | Glucose | CHEMBL462920 |
CHEMBL1068134
(1)
|
1 / 1 |
| P31639 | Sodium/glucose cotransporter 2 | Glucose | CHEMBL462920 |
CHEMBL1068133
(1)
|
1 / 1 |