| id | C00029620 | 
|---|---|
| Name | Acerogenin B | 
| CAS RN | 74174-17-7 | 
| Standard InChI | InChI=1S/C19H22O3/c20-16-4-2-1-3-14-6-10-17(11-7-14)22-19-13-15(5-9-16)8-12-18(19)21/h6-8,10-13,16,20-21H,1-5,9H2 | 
| Standard InChI (Main Layer) | InChI=1S/C19H22O3/c20-16-4-2-1-3-14-6-10-17(11-7-14)22-19-13-15(5-9-16)8-12-18(19)21/h6-8,10-13,16,20-21H,1-5,9H2 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1677 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL462920 CHEMBL1778760 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Acer nikoense | 171213 | Aceraceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | 
                        # of diseases
                         (OMIM / KEGG)  | 
                    
|---|---|---|---|---|---|
| P13866 | Sodium/glucose cotransporter 1 | Glucose | CHEMBL462920 | 
                        CHEMBL1068134
                        (1)
                         | 
                      1 / 1 | 
| P31639 | Sodium/glucose cotransporter 2 | Glucose | CHEMBL462920 | 
                        CHEMBL1068133
                        (1)
                         | 
                      1 / 1 |