id | C00029691 |
---|---|
Name | Anhydroecgonine methyl ester |
CAS RN | 43021-26-7 |
Standard InChI | InChI=1S/C10H15NO2/c1-11-7-3-5-8(10(12)13-2)9(11)6-4-7/h5,7,9H,3-4,6H2,1-2H3/t7-,9-/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C10H15NO2/c1-11-7-3-5-8(10(12)13-2)9(11)6-4-7/h5,7,9H,3-4,6H2,1-2H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 7696 |
By standard InChI | CHEMBL451136 |
---|---|
By standard InChI Main Layer | CHEMBL412663 CHEMBL451136 |
By LinkDB |
---|
By CAS RN | C068464 |
---|
class name | count |
---|---|
rosids | 1 |
family name | count |
---|---|
Erythroxylaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Erythroxylum emarginatum | 992695 | Erythroxylaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q12809 | Potassium voltage-gated channel subfamily H member 2 | KCNH, Kv10-12.x (Ether-a-go-go) | CHEMBL412663 CHEMBL451136 |
CHEMBL1036648
(1)
CHEMBL1676103
(2)
|
2 / 2 |
P11229 | Muscarinic acetylcholine receptor M1 | Acetylcholine receptor | CHEMBL412663 |
CHEMBL744760
(1)
|
0 / 0 |
P20309 | Muscarinic acetylcholine receptor M3 | Acetylcholine receptor | CHEMBL412663 |
CHEMBL746954
(1)
|
1 / 0 |