| id | C00029691 |
|---|---|
| Name | Anhydroecgonine methyl ester |
| CAS RN | 43021-26-7 |
| Standard InChI | InChI=1S/C10H15NO2/c1-11-7-3-5-8(10(12)13-2)9(11)6-4-7/h5,7,9H,3-4,6H2,1-2H3/t7-,9-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C10H15NO2/c1-11-7-3-5-8(10(12)13-2)9(11)6-4-7/h5,7,9H,3-4,6H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7696 |
| By standard InChI | CHEMBL451136 |
|---|---|
| By standard InChI Main Layer | CHEMBL412663 CHEMBL451136 |
| By LinkDB |
|---|
| By CAS RN | C068464 |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Erythroxylaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Erythroxylum emarginatum | 992695 | Erythroxylaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q12809 | Potassium voltage-gated channel subfamily H member 2 | KCNH, Kv10-12.x (Ether-a-go-go) | CHEMBL412663 CHEMBL451136 |
CHEMBL1036648
(1)
CHEMBL1676103
(2)
|
2 / 2 |
| P11229 | Muscarinic acetylcholine receptor M1 | Acetylcholine receptor | CHEMBL412663 |
CHEMBL744760
(1)
|
0 / 0 |
| P20309 | Muscarinic acetylcholine receptor M3 | Acetylcholine receptor | CHEMBL412663 |
CHEMBL746954
(1)
|
1 / 0 |