id | C00002978 |
---|---|
Name | Acrovestone |
CAS RN | 24177-16-0 |
Standard InChI | InChI=1S/C32H42O8/c1-15(2)10-12-20-27(35)23(18(7)33)30(38)25(28(20)36)22(14-17(5)6)26-29(37)21(13-11-16(3)4)32(40-9)24(19(8)34)31(26)39/h10-11,17,22,35-39H,12-14H2,1-9H3 |
Standard InChI (Main Layer) | InChI=1S/C32H42O8/c1-15(2)10-12-20-27(35)23(18(7)33)30(38)25(28(20)36)22(14-17(5)6)26-29(37)21(13-11-16(3)4)32(40-9)24(19(8)34)31(26)39/h10-11,17,22,35-39H,12-14H2,1-9H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 4906 |
By standard InChI | CHEMBL488313 |
---|---|
By standard InChI Main Layer | CHEMBL513957 CHEMBL488313 |
By LinkDB | C09916 |
---|
By CAS RN | C061305 |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Acronychia pedunculata | 354485 | Rutaceae | rosids | Viridiplantae |
Acronychia vestita | 354487 | Rutaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P14679 | Tyrosinase | Oxidoreductase | CHEMBL513957 |
CHEMBL985004
(1)
|
4 / 2 |