| id | C00002978 |
|---|---|
| Name | Acrovestone |
| CAS RN | 24177-16-0 |
| Standard InChI | InChI=1S/C32H42O8/c1-15(2)10-12-20-27(35)23(18(7)33)30(38)25(28(20)36)22(14-17(5)6)26-29(37)21(13-11-16(3)4)32(40-9)24(19(8)34)31(26)39/h10-11,17,22,35-39H,12-14H2,1-9H3 |
| Standard InChI (Main Layer) | InChI=1S/C32H42O8/c1-15(2)10-12-20-27(35)23(18(7)33)30(38)25(28(20)36)22(14-17(5)6)26-29(37)21(13-11-16(3)4)32(40-9)24(19(8)34)31(26)39/h10-11,17,22,35-39H,12-14H2,1-9H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4906 |
| By standard InChI | CHEMBL488313 |
|---|---|
| By standard InChI Main Layer | CHEMBL513957 CHEMBL488313 |
| By LinkDB | C09916 |
|---|
| By CAS RN | C061305 |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Acronychia pedunculata | 354485 | Rutaceae | rosids | Viridiplantae |
| Acronychia vestita | 354487 | Rutaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P14679 | Tyrosinase | Oxidoreductase | CHEMBL513957 |
CHEMBL985004
(1)
|
4 / 2 |