| id | C00003006 |
|---|---|
| Name | Monocerin |
| CAS RN | 30270-60-1 |
| Standard InChI | InChI=1S/C16H20O6/c1-4-5-8-6-11-14(21-8)9-7-10(19-2)15(20-3)13(17)12(9)16(18)22-11/h7-8,11,14,17H,4-6H2,1-3H3/t8-,11+,14+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C16H20O6/c1-4-5-8-6-11-14(21-8)9-7-10(19-2)15(20-3)13(17)12(9)16(18)22-11/h7-8,11,14,17H,4-6H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 8471 |
| By standard InChI | CHEMBL488513 |
|---|---|
| By standard InChI Main Layer | CHEMBL488513 |
| By LinkDB | C09953 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Pleosporaceae | 2 |
| Nectriaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Exserohilum rostratum | 45150 | Pleosporaceae | Fungi | |
| Exserohilum turcicum | 93612 | Pleosporaceae | Fungi | |
| Fusarium larvarum | 57146 | Nectriaceae | Fungi | |
| Helminthosporium monoceras | 58127 | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P47989 | Xanthine dehydrogenase/oxidase | Oxidoreductase | CHEMBL488513 |
CHEMBL1671286
(1)
|
1 / 1 |
| P11511 | Cytochrome P450 19A1 | Cytochrome P450 19A1 | CHEMBL488513 |
CHEMBL1671282
(1)
|
2 / 2 |