id | C00003019 |
---|---|
Name | Tremulacin |
CAS RN | 29836-40-6 |
Standard InChI | InChI=1S/C27H28O11/c28-14-19-21(30)22(31)23(38-24(32)16-8-2-1-3-9-16)25(37-19)36-18-11-5-4-10-17(18)15-35-26(33)27(34)13-7-6-12-20(27)29/h1-5,7-11,13,19,21-23,25,28,30-31,34H,6,12,14-15H2/t19?,21-,22+,23?,25-,27?/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C27H28O11/c28-14-19-21(30)22(31)23(38-24(32)16-8-2-1-3-9-16)25(37-19)36-18-11-5-4-10-17(18)15-35-26(33)27(34)13-7-6-12-20(27)29/h1-5,7-11,13,19,21-23,25,28,30-31,34H,6,12,14-15H2 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 679 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL462996 CHEMBL1982093 |
By LinkDB | C09973 |
---|
By CAS RN | C095421 |
---|
class name | count |
---|---|
rosids | 6 |
family name | count |
---|---|
Salicaceae | 6 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Dovyalis hebecarpa | 688332 | Salicaceae | rosids | Viridiplantae |
Homalium cochinchinensis | 179710 | Salicaceae | rosids | Viridiplantae |
Itoa orientalis | 179731 | Salicaceae | rosids | Viridiplantae |
Populus alba | 43335 | Salicaceae | rosids | Viridiplantae |
Populus tremula | 113636 | Salicaceae | rosids | Viridiplantae |
Populus tremuloides | 3693 | Salicaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL462996 |
CHEMBL973285
(1)
|
0 / 3 |