| id | C00030495 |
|---|---|
| Name | Hydrangenoside A |
| CAS RN | 74474-42-3 |
| Standard InChI | InChI=1S/C31H40O13/c1-3-22-23(13-21-12-19(35)11-20(42-21)10-18(34)9-6-16-4-7-17(33)8-5-16)24(29(39)40-2)15-41-30(22)44-31-28(38)27(37)26(36)25(14-32)43-31/h3-5,7-8,15,20-23,25-28,30-33,36-38H,1,6,9-14H2,2H3/t20-,21+,22+,23-,25+,26+,27-,28+,30-,31-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C31H40O13/c1-3-22-23(13-21-12-19(35)11-20(42-21)10-18(34)9-6-16-4-7-17(33)8-5-16)24(29(39)40-2)15-41-30(22)44-31-28(38)27(37)26(36)25(14-32)43-31/h3-5,7-8,15,20-23,25-28,30-33,36-38H,1,6,9-14H2,2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1372 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1606388 CHEMBL1896604 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| family name | count |
|---|---|
| Hydrangeaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Hydrangea chinensis | 498914 | Hydrangeaceae | asterids | Viridiplantae |
| Hydrangea macrophylla subsp.serrata (Thunb.) Makino | 23109 | Hydrangeaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11473 | Vitamin D3 receptor | NR1I1 | CHEMBL1896604 |
CHEMBL1794311
(1)
|
2 / 3 |
| O75496 | Geminin | Unclassified protein | CHEMBL1896604 |
CHEMBL2114780
(1)
|
0 / 0 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL1896604 |
CHEMBL1794401
(1)
|
0 / 0 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1896604 |
CHEMBL1794483
(1)
|
0 / 0 |
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL1606388 |
CHEMBL2354311
(1)
|
1 / 0 |