| id | C00030674 |
|---|---|
| Name | Linderofruticoside A / (-)-Linderofruticoside A |
| CAS RN | 1049759-34-3 |
| Standard InChI | InChI=1S/C17H20O11/c18-9-2-1-7-3-8(9)14(22)25-5-17(23)6-26-16(13(17)21)28-12-11(20)10(19)4-24-15(12)27-7/h1-3,10-13,15-16,18-21,23H,4-6H2/t10-,11+,12-,13+,15-,16+,17-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C17H20O11/c18-9-2-1-7-3-8(9)14(22)25-5-17(23)6-26-16(13(17)21)28-12-11(20)10(19)4-24-15(12)27-7/h1-3,10-13,15-16,18-21,23H,4-6H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7463 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Lauraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Lindera fruticosa | 155292 | Lauraceae | Magnoliophyta | Viridiplantae |