| id | C00030761 |
|---|---|
| Name | Methyl p-anisate |
| CAS RN | 121-98-2 |
| Standard InChI | InChI=1S/C9H10O3/c1-11-8-5-3-7(4-6-8)9(10)12-2/h3-6H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C9H10O3/c1-11-8-5-3-7(4-6-8)9(10)12-2/h3-6H,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1936 |
| By standard InChI | CHEMBL1762668 |
|---|---|
| By standard InChI Main Layer | CHEMBL1762668 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Phellodendron amurense | 68554 | Rutaceae | rosids | Viridiplantae |
| Phellodendron japonicum MAXIM | 68553 | Rutaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00918 | Carbonic anhydrase 2 | Lyase | CHEMBL1762668 |
CHEMBL1762939
(1)
|
1 / 2 |
| P00915 | Carbonic anhydrase 1 | Lyase | CHEMBL1762668 |
CHEMBL1762938
(1)
|
0 / 0 |