| id | C00030799 |
|---|---|
| Name | Myricetin 3-O-beta-D-glucuronide |
| CAS RN | 77363-65-6 |
| Standard InChI | InChI=1S/C21H18O14/c22-6-3-7(23)11-10(4-6)33-17(5-1-8(24)12(26)9(25)2-5)18(13(11)27)34-21-16(30)14(28)15(29)19(35-21)20(31)32/h1-4,14-16,19,21-26,28-30H,(H,31,32)/t14-,15-,16+,19-,21+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H18O14/c22-6-3-7(23)11-10(4-6)33-17(5-1-8(24)12(26)9(25)2-5)18(13(11)27)34-21-16(30)14(28)15(29)19(35-21)20(31)32/h1-4,14-16,19,21-26,28-30H,(H,31,32) |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 2 |
| By standard InChI | CHEMBL458470 |
|---|---|
| By standard InChI Main Layer | CHEMBL458470 |
| By LinkDB |
|---|
| By CAS RN | C072578 |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Onagraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Oenothera cheiranthifolia | 3939 | Onagraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL458470 |
CHEMBL1008495
(1)
|
0 / 3 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL458470 |
CHEMBL1008496
(1)
|
0 / 0 |