| id | C00030884 |
|---|---|
| Name | Odoratisol B |
| CAS RN | 891182-94-8 |
| Standard InChI | InChI=1S/C20H24O5/c1-5-6-14-7-10-17(19(11-14)24-4)25-13(2)20(22)15-8-9-16(21)18(12-15)23-3/h5-13,20-22H,1-4H3/b6-5+/t13-,20-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H24O5/c1-5-6-14-7-10-17(19(11-14)24-4)25-13(2)20(22)15-8-9-16(21)18(12-15)23-3/h5-13,20-22H,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1504 |
| By standard InChI | CHEMBL1909926 |
|---|---|
| By standard InChI Main Layer | CHEMBL185692 CHEMBL1437438 CHEMBL1909926 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Lauraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Machilus odoratissima NEES | 251260 | Lauraceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1437438 |
CHEMBL1614458
(1)
|
0 / 0 |