| id | C00031014 |
|---|---|
| Name | 4-Hydroxycinnamaldehyde / p-Hydroxycinnamaldehyde |
| CAS RN | 2538-87-6 |
| Standard InChI | InChI=1S/C9H8O2/c10-7-1-2-8-3-5-9(11)6-4-8/h1-7,11H/b2-1+ |
| Standard InChI (Main Layer) | InChI=1S/C9H8O2/c10-7-1-2-8-3-5-9(11)6-4-8/h1-7,11H |
| Phytochemical cluster | No. 6 |
|---|---|
| KCF-S cluster | No. 1979 |
| By standard InChI | CHEMBL431836 |
|---|---|
| By standard InChI Main Layer | CHEMBL431836 CHEMBL1956164 |
| By LinkDB | C05608 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Spermatophyta | 1 |
| rosids | 1 |
| family name | count |
|---|---|
| Cupressaceae | 1 |
| Rosaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Chamaecyparis formosensis | 187461 | Cupressaceae | Spermatophyta | Viridiplantae |
| Spiraea formosana | 409510 | Rosaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL431836 |
CHEMBL1614458
(1)
|
0 / 0 |
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL431836 |
CHEMBL1614421
(1)
CHEMBL1614502
(1)
|
4 / 3 |
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL431836 |
CHEMBL1613914
(1)
|
0 / 0 |