| id | C00031108 |
|---|---|
| Name | Pteroside C |
| CAS RN | 35910-17-9 |
| Standard InChI | InChI=1S/C20H28O8/c1-8-6-12-14(16(23)10(3)15(12)22)9(2)11(8)4-5-27-20-19(26)18(25)17(24)13(7-21)28-20/h6,10,13,15,17-22,24-26H,4-5,7H2,1-3H3/t10-,13-,15-,17-,18+,19-,20-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H28O8/c1-8-6-12-14(16(23)10(3)15(12)22)9(2)11(8)4-5-27-20-19(26)18(25)17(24)13(7-21)28-20/h6,10,13,15,17-22,24-26H,4-5,7H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 635 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1892637 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Euphyllophyta | 2 |
| family name | count |
|---|---|
| Dennstaedtiaceae | 1 |
| Pteridaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Pteridium aquilinum | 32101 | Dennstaedtiaceae | Euphyllophyta | Viridiplantae |
| Pteris multifida | 170715 | Pteridaceae | Euphyllophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL1892637 |
CHEMBL2114784
(1)
|
1 / 1 |
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL1892637 |
CHEMBL1794584
(1)
|
2 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL1892637 |
CHEMBL2114843
(1)
|
0 / 0 |
| Q9HC16 | DNA dC->dU-editing enzyme APOBEC-3G | Enzyme | CHEMBL1892637 |
CHEMBL1963863
(1)
|
0 / 0 |