| id | C00031299 | 
|---|---|
| Name | Sarcophytoxide / (+)-Sarcophytoxide | 
| CAS RN | 74841-41-1 | 
| Standard InChI | InChI=1S/C20H30O2/c1-14-6-5-11-20(4)19(22-20)10-8-15(2)12-18-17(9-7-14)16(3)13-21-18/h6,12,18-19H,5,7-11,13H2,1-4H3/b14-6+,15-12-/t18-,19-,20-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C20H30O2/c1-14-6-5-11-20(4)19(22-20)10-8-15(2)12-18-17(9-7-14)16(3)13-21-18/h6,12,18-19H,5,7-11,13H2,1-4H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2000 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL472013 CHEMBL496841 CHEMBL515061 CHEMBL560225 CHEMBL1761950 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Alcyoniidae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Sarcophyton mililatensis | 358803 | Alcyoniidae | Metazoa | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q96RI1 | Bile acid receptor | NR1H4 | CHEMBL560225 | CHEMBL1027008
                        (1)
                        CHEMBL1027009
                        (1) | 0 / 0 | 
| Q99814 | Endothelial PAS domain-containing protein 1 | Unclassified protein | CHEMBL1761950 | CHEMBL1762876
                        (1) | 1 / 1 | 
| P06239 | Tyrosine-protein kinase Lck | Src | CHEMBL472013 | CHEMBL1030952
                        (1) | 0 / 1 | 
| P04054 | Phospholipase A2 | Enzyme | CHEMBL560225 | CHEMBL1026212
                        (1)
                        CHEMBL1026996
                        (1) | 0 / 0 |