| id | C00031452 |
|---|---|
| Name | (-)-Pinoresinol di-O-beta-D-glucopyranoside |
| CAS RN | 63902-38-5 |
| Standard InChI | InChI=1S/C32H42O16/c1-41-19-7-13(3-5-17(19)45-31-27(39)25(37)23(35)21(9-33)47-31)29-15-11-44-30(16(15)12-43-29)14-4-6-18(20(8-14)42-2)46-32-28(40)26(38)24(36)22(10-34)48-32/h3-8,15-16,21-40H,9-12H2,1-2H3/t15-,16-,21+,22+,23+,24+,25-,26-,27+,28+,29+,30?,31+,32+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C32H42O16/c1-41-19-7-13(3-5-17(19)45-31-27(39)25(37)23(35)21(9-33)47-31)29-15-11-44-30(16(15)12-43-29)14-4-6-18(20(8-14)42-2)46-32-28(40)26(38)24(36)22(10-34)48-32/h3-8,15-16,21-40H,9-12H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 152 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL450911 CHEMBL573785 CHEMBL1712579 |
| By LinkDB |
|---|
| By CAS RN | C013200 |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Balanophoraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Balanophora japonica | 1128102 | Balanophoraceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O75496 | Geminin | Unclassified protein | CHEMBL1712579 |
CHEMBL2114843
(1)
CHEMBL2114780
(1)
|
0 / 0 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL1712579 |
CHEMBL1738588
(1)
|
0 / 0 |