| id | C00031561 | 
|---|---|
| Name | Acerogenin C | 
| CAS RN | 87425-32-9 | 
| Standard InChI | InChI=1S/C19H20O3/c20-16-4-2-1-3-15-8-12-18(21)19(13-15)22-17-10-6-14(5-9-16)7-11-17/h6-8,10-13,21H,1-5,9H2 | 
| Standard InChI (Main Layer) | InChI=1S/C19H20O3/c20-16-4-2-1-3-15-8-12-18(21)19(13-15)22-17-10-6-14(5-9-16)7-11-17/h6-8,10-13,21H,1-5,9H2 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1677 | 
| By standard InChI | CHEMBL589990 | 
|---|---|
| By standard InChI Main Layer | CHEMBL589990 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| rosids | 1 | 
| family name | count | 
|---|---|
| Burseraceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Boswellia ovalifoliolata | 613108 | Burseraceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | 
                        # of diseases
                         (OMIM / KEGG)  | 
                    
|---|---|---|---|---|---|
| P13866 | Sodium/glucose cotransporter 1 | Glucose | CHEMBL589990 | 
                        CHEMBL1068134
                        (1)
                         | 
                      1 / 1 | 
| P31639 | Sodium/glucose cotransporter 2 | Glucose | CHEMBL589990 | 
                        CHEMBL1068133
                        (1)
                         | 
                      1 / 1 |