| id | C00031779 |
|---|---|
| Name | Ethyl ferulate |
| CAS RN | 4046-02-0 |
| Standard InChI | InChI=1S/C12H14O4/c1-3-16-12(14)7-5-9-4-6-10(13)11(8-9)15-2/h4-8,13H,3H2,1-2H3/b7-5+ |
| Standard InChI (Main Layer) | InChI=1S/C12H14O4/c1-3-16-12(14)7-5-9-4-6-10(13)11(8-9)15-2/h4-8,13H,3H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 876 |
| By standard InChI | CHEMBL286796 |
|---|---|
| By standard InChI Main Layer | CHEMBL286796 |
| By LinkDB |
|---|
| By CAS RN | C099085 |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Spiraea formosana | 409510 | Rosaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P27338 | Amine oxidase [flavin-containing] B | Oxidoreductase | CHEMBL286796 |
CHEMBL1059215
(1)
|
0 / 0 |
| Q04760 | Lactoylglutathione lyase | Enzyme | CHEMBL286796 |
CHEMBL1670272
(1)
|
0 / 0 |