id | C00031779 |
---|---|
Name | Ethyl ferulate |
CAS RN | 4046-02-0 |
Standard InChI | InChI=1S/C12H14O4/c1-3-16-12(14)7-5-9-4-6-10(13)11(8-9)15-2/h4-8,13H,3H2,1-2H3/b7-5+ |
Standard InChI (Main Layer) | InChI=1S/C12H14O4/c1-3-16-12(14)7-5-9-4-6-10(13)11(8-9)15-2/h4-8,13H,3H2,1-2H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 876 |
By standard InChI | CHEMBL286796 |
---|---|
By standard InChI Main Layer | CHEMBL286796 |
By LinkDB |
---|
By CAS RN | C099085 |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Spiraea formosana | 409510 | Rosaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P27338 | Amine oxidase [flavin-containing] B | Oxidoreductase | CHEMBL286796 |
CHEMBL1059215
(1)
|
0 / 0 |
Q04760 | Lactoylglutathione lyase | Enzyme | CHEMBL286796 |
CHEMBL1670272
(1)
|
0 / 0 |