| id | C00031911 |
|---|---|
| Name | Isoravenelone |
| CAS RN | 572886-53-4 |
| Standard InChI | InChI=1S/C27H22O5/c1-31-26(29)23(20-15-9-4-10-16-20)22(19-13-7-3-8-14-19)24-25(28)21(32-27(24)30)17-18-11-5-2-6-12-18/h2-17,22-23,28H,1H3/b21-17+/t22?,23-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C27H22O5/c1-31-26(29)23(20-15-9-4-10-16-20)22(19-13-7-3-8-14-19)24-25(28)21(32-27(24)30)17-18-11-5-2-6-12-18/h2-17,22-23,28H,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1821 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL517450 CHEMBL463211 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Boletaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Pulveroboletus ravenelii | 80668 | Boletaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL463211 |
CHEMBL960263
(1)
|
0 / 3 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL463211 |
CHEMBL960262
(1)
|
0 / 0 |