| id | C00031993 |
|---|---|
| Name | Machilin C / (-)-Machilin C |
| CAS RN | 110269-51-7 |
| Standard InChI | InChI=1S/C20H24O5/c1-5-6-14-7-10-17(19(11-14)24-4)25-13(2)20(22)15-8-9-16(21)18(12-15)23-3/h5-13,20-22H,1-4H3/b6-5+/t13-,20-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H24O5/c1-5-6-14-7-10-17(19(11-14)24-4)25-13(2)20(22)15-8-9-16(21)18(12-15)23-3/h5-13,20-22H,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1504 |
| By standard InChI | CHEMBL1909926 |
|---|---|
| By standard InChI Main Layer | CHEMBL185692 CHEMBL1437438 CHEMBL1909926 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Leucas aspera | 483811 | Lamiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1437438 |
CHEMBL1614458
(1)
|
0 / 0 |