| id | C00003227 | 
|---|---|
| Name | Calaxin | 
| CAS RN | 30412-86-3 | 
| Standard InChI | InChI=1S/C19H20O6/c1-9(2)17(21)24-14-8-19(5)15(20)7-12(25-19)10(3)6-13-16(14)11(4)18(22)23-13/h6-7,13-14,16H,1,4,8H2,2-3,5H3/b10-6-/t13-,14-,16+,19-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C19H20O6/c1-9(2)17(21)24-14-8-19(5)15(20)7-12(25-19)10(3)6-13-16(14)11(4)18(22)23-13/h6-7,13-14,16H,1,4,8H2,2-3,5H3 | 
| Phytochemical cluster | No. 38 | 
|---|---|
| KCF-S cluster | No. 366 | 
| By standard InChI | CHEMBL189790 | 
|---|---|
| By standard InChI Main Layer | CHEMBL189790 | 
| By LinkDB | C09353 | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| asterids | 3 | 
| family name | count | 
|---|---|
| Asteraceae | 3 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Calea axillaris | 183008 | Asteraceae | asterids | Viridiplantae | 
| Helianthus ciliaris | 73280 | Asteraceae | asterids | Viridiplantae | 
| Viguiera eriophora ssp.eriophora | 73317 | Asteraceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q04206 | Transcription factor p65 | Transcription Factor | CHEMBL189790 | CHEMBL828644
                        (1)
                        CHEMBL835063
                        (1) CHEMBL861583 (1) | 0 / 0 | 
| Q00653 | Nuclear factor NF-kappa-B p100 subunit | Transcription Factor | CHEMBL189790 | CHEMBL828644
                        (1)
                        CHEMBL835063
                        (1) | 0 / 0 | 
| P19838 | Nuclear factor NF-kappa-B p105 subunit | Transcription Factor | CHEMBL189790 | CHEMBL828644
                        (1)
                        CHEMBL835063
                        (1) | 0 / 0 |