| id | C00032473 |
|---|---|
| Name | Variecolol / (+)-Variecolol |
| CAS RN | 253664-30-1 |
| Standard InChI | InChI=1S/C25H38O2/c1-15(2)18-8-9-23(4)10-11-24(5)13-19-16(3)12-25(26)21(19)17(14-27-25)6-7-20(24)22(18)23/h6,16,18-22,26H,1,7-14H2,2-5H3/b17-6-/t16-,18+,19-,20-,21-,22-,23-,24+,25+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C25H38O2/c1-15(2)18-8-9-23(4)10-11-24(5)13-19-16(3)12-25(26)21(19)17(14-27-25)6-7-20(24)22(18)23/h6,16,18-22,26H,1,7-14H2,2-5H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2645 |
| By standard InChI | CHEMBL484427 |
|---|---|
| By standard InChI Main Layer | CHEMBL484427 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Aspergillaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Emericella aurantio-brunnea | ||||
| Emericella aurantiobrunnea | 41725 | Aspergillaceae | Fungi | |
| Emericella purpurea | 91485 | Aspergillaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P51681 | C-C chemokine receptor type 5 | CC chemokine receptor | CHEMBL484427 |
CHEMBL965944
(1)
|
3 / 0 |