| id | C00032503 |
|---|---|
| Name | Vulpinic acid |
| CAS RN | 521-52-8 |
| Standard InChI | InChI=1S/C19H14O5/c1-23-18(21)15(13-10-6-3-7-11-13)17-16(20)14(19(22)24-17)12-8-4-2-5-9-12/h2-11,20H,1H3/b17-15+ |
| Standard InChI (Main Layer) | InChI=1S/C19H14O5/c1-23-18(21)15(13-10-6-3-7-11-13)17-16(20)14(19(22)24-17)12-8-4-2-5-9-12/h2-11,20H,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 6605 |
| By standard InChI | CHEMBL463212 |
|---|---|
| By standard InChI Main Layer | CHEMBL463212 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Boletaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Pulveroboletus ravenelii | 80668 | Boletaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL463212 |
CHEMBL960262
(1)
|
0 / 0 |
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL463212 |
CHEMBL1614421
(1)
|
4 / 3 |