id | C00032905 |
---|---|
Name | D-Glycero-D-galacto-heptitol |
CAS RN | 527-06-0 |
Standard InChI | InChI=1S/C7H16O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3-14H,1-2H2 |
Standard InChI (Main Layer) | InChI=1S/C7H16O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3-14H,1-2H2 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 630 |
By standard InChI | CHEMBL1597273 |
---|---|
By standard InChI Main Layer | CHEMBL1597273 |
By LinkDB | C08255 |
---|
By CAS RN | C025642 |
---|
class name | count |
---|---|
eudicotyledons | 1 |
family name | count |
---|---|
Loranthaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Scurrula fusca | 227900 | Loranthaceae | eudicotyledons | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL1597273 |
CHEMBL1614211
(1)
|
0 / 0 |
Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1597273 |
CHEMBL1794536
(1)
|
0 / 0 |
Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 | Enzyme | CHEMBL1597273 |
CHEMBL1614364
(1)
|
1 / 1 |