| id | C00032905 |
|---|---|
| Name | D-Glycero-D-galacto-heptitol |
| CAS RN | 527-06-0 |
| Standard InChI | InChI=1S/C7H16O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3-14H,1-2H2 |
| Standard InChI (Main Layer) | InChI=1S/C7H16O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3-14H,1-2H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 630 |
| By standard InChI | CHEMBL1597273 |
|---|---|
| By standard InChI Main Layer | CHEMBL1597273 |
| By LinkDB | C08255 |
|---|
| By CAS RN | C025642 |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Loranthaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Scurrula fusca | 227900 | Loranthaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL1597273 |
CHEMBL1614211
(1)
|
0 / 0 |
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1597273 |
CHEMBL1794536
(1)
|
0 / 0 |
| Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 | Enzyme | CHEMBL1597273 |
CHEMBL1614364
(1)
|
1 / 1 |