| id | C00003292 |
|---|---|
| Name | Glechomanolide |
| CAS RN | 38146-68-8 |
| Standard InChI | InChI=1S/C15H20O2/c1-10-5-4-6-11(2)9-14-13(8-7-10)12(3)15(16)17-14/h6-7,14H,4-5,8-9H2,1-3H3/b10-7+,11-6-/t14-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H20O2/c1-10-5-4-6-11(2)9-14-13(8-7-10)12(3)15(16)17-14/h6-7,14H,4-5,8-9H2,1-3H3 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 1710 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL450885 |
| By LinkDB | C09466 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| Magnoliophyta | 1 |
| Liliopsida | 1 |
| rosids | 1 |
| family name | count |
|---|---|
| Lamiaceae | 1 |
| Chloranthaceae | 1 |
| Zingiberaceae | 1 |
| Rutaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Chloranthus tianmushanensis | 13005 | Chloranthaceae | Magnoliophyta | Viridiplantae |
| Curcuma zedoaria | 136224 | Zingiberaceae | Liliopsida | Viridiplantae |
| Glechoma hederacea | 28509 | Lamiaceae | asterids | Viridiplantae |
| Vepris punctata | 430986 | Rutaceae | rosids | Viridiplantae |