| id | C00003293 | 
|---|---|
| Name | Goyazensolide | 
| CAS RN | 60066-35-5 | 
| Standard InChI | InChI=1S/C19H20O7/c1-9(2)17(22)25-14-7-19(4)15(21)6-12(26-19)11(8-20)5-13-16(14)10(3)18(23)24-13/h5-6,13-14,16,20H,1,3,7-8H2,2,4H3/b11-5+/t13-,14+,16+,19-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C19H20O7/c1-9(2)17(22)25-14-7-19(4)15(21)6-12(26-19)11(8-20)5-13-16(14)10(3)18(23)24-13/h5-6,13-14,16,20H,1,3,7-8H2,2,4H3 | 
| Phytochemical cluster | No. 38 | 
|---|---|
| KCF-S cluster | No. 366 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL371358 CHEMBL1173296 | 
| By LinkDB | C09467 | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| asterids | 4 | 
| family name | count | 
|---|---|
| Asteraceae | 4 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Eremanthus goyazensis | 434654 | Asteraceae | asterids | Viridiplantae | 
| Lychnophora passerina | 41601 | Asteraceae | asterids | Viridiplantae | 
| Vanillosmopsis brasiliensis | 4210 | Asteraceae | asterids | Viridiplantae | 
| Vanillosmopsis pohlii | 4210 | Asteraceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q04206 | Transcription factor p65 | Transcription Factor | CHEMBL371358 | CHEMBL828644
                        (1)
                        CHEMBL835063
                        (1) CHEMBL861583 (1) | 0 / 0 | 
| Q00653 | Nuclear factor NF-kappa-B p100 subunit | Transcription Factor | CHEMBL371358 | CHEMBL828644
                        (1)
                        CHEMBL835063
                        (1) | 0 / 0 | 
| P19838 | Nuclear factor NF-kappa-B p105 subunit | Transcription Factor | CHEMBL371358 | CHEMBL828644
                        (1)
                        CHEMBL835063
                        (1) | 0 / 0 |