| id | C00003322 |
|---|---|
| Name | Melampodin A |
| CAS RN | 35852-26-7 |
| Standard InChI | InChI=1S/C21H24O9/c1-8-6-12-14(9(2)18(23)28-12)17(29-20(25)21(4)10(3)30-21)15(22)11(19(24)26-5)7-13-16(8)27-13/h6-7,10,12-17,22H,2H2,1,3-5H3/b8-6+,11-7+/t10-,12-,13-,14+,15+,16+,17+,21-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H24O9/c1-8-6-12-14(9(2)18(23)28-12)17(29-20(25)21(4)10(3)30-21)15(22)11(19(24)26-5)7-13-16(8)27-13/h6-7,10,12-17,22H,2H2,1,3-5H3 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 694 |
| By standard InChI | CHEMBL463559 |
|---|---|
| By standard InChI Main Layer | CHEMBL463559 CHEMBL1995758 |
| By LinkDB | C09500 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| family name | count |
|---|---|
| Asteraceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Melampodium heterophyllum | 176608 | Asteraceae | asterids | Viridiplantae |
| Melampodium leucanthum | 183048 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL463559 |
CHEMBL1008495
(1)
|
0 / 3 |