| id | C00003366 | 
|---|---|
| Name | Saupirin / sauparine | 
| CAS RN | 35932-39-9 | 
| Standard InChI | InChI=1S/C19H22O6/c1-8-5-14(24-18(22)9(2)7-20)16-11(4)19(23)25-17(16)15-10(3)13(21)6-12(8)15/h12-17,20-21H,1-7H2 | 
| Standard InChI (Main Layer) | InChI=1S/C19H22O6/c1-8-5-14(24-18(22)9(2)7-20)16-11(4)19(23)25-17(16)15-10(3)13(21)6-12(8)15/h12-17,20-21H,1-7H2 | 
| Phytochemical cluster | No. 38 | 
|---|---|
| KCF-S cluster | No. 206 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL374146 | 
| By LinkDB | C09547 | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| asterids | 2 | 
| family name | count | 
|---|---|
| Asteraceae | 2 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Saussurea neopulchella | 378329 | Asteraceae | asterids | Viridiplantae | 
| Saussurea pulchella | 243817 | Asteraceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | 
                        # of diseases
                         (OMIM / KEGG)  | 
                    
|---|---|---|---|---|---|
| Q04206 | Transcription factor p65 | Transcription Factor | CHEMBL374146 | 
                        CHEMBL2317103
                        (1)
                        CHEMBL2317104
                        (1)
                         CHEMBL2317105 (1) CHEMBL2317106 (1) CHEMBL2317107 (1)  | 
                      0 / 0 |