| id | C00003366 |
|---|---|
| Name | Saupirin / sauparine |
| CAS RN | 35932-39-9 |
| Standard InChI | InChI=1S/C19H22O6/c1-8-5-14(24-18(22)9(2)7-20)16-11(4)19(23)25-17(16)15-10(3)13(21)6-12(8)15/h12-17,20-21H,1-7H2 |
| Standard InChI (Main Layer) | InChI=1S/C19H22O6/c1-8-5-14(24-18(22)9(2)7-20)16-11(4)19(23)25-17(16)15-10(3)13(21)6-12(8)15/h12-17,20-21H,1-7H2 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 206 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL374146 |
| By LinkDB | C09547 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| family name | count |
|---|---|
| Asteraceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Saussurea neopulchella | 378329 | Asteraceae | asterids | Viridiplantae |
| Saussurea pulchella | 243817 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q04206 | Transcription factor p65 | Transcription Factor | CHEMBL374146 |
CHEMBL2317103
(1)
CHEMBL2317104
(1)
CHEMBL2317105 (1) CHEMBL2317106 (1) CHEMBL2317107 (1) |
0 / 0 |