| id | C00033660 |
|---|---|
| Name | beta-Ylangene |
| CAS RN | 20479-06-5 |
| Standard InChI | InChI=1S/C15H24/c1-9(2)11-7-8-15(4)12-6-5-10(3)14(15)13(11)12/h9,11-14H,3,5-8H2,1-2,4H3/t11-,12?,13?,14-,15-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H24/c1-9(2)11-7-8-15(4)12-6-5-10(3)14(15)13(11)12/h9,11-14H,3,5-8H2,1-2,4H3 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 333 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| Magnoliophyta | 1 |
| Embryophyta | 1 |
| family name | count |
|---|---|
| Cistaceae | 1 |
| Annonaceae | 1 |
| Gymnomitriaceae | 1 |
| Burseraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cistus creticus | 191224 | Cistaceae | rosids | Viridiplantae |
| Commiphora holtziana | 43868 | Burseraceae | rosids | Viridiplantae |
| Guatteriopsis blepharophylla | 402568 | Annonaceae | Magnoliophyta | Viridiplantae |
| Marsupella emarginata | 253513 | Gymnomitriaceae | Embryophyta | Viridiplantae |