| id | C00033749 |
|---|---|
| Name | Cytosporone C |
| CAS RN | 321661-63-6 |
| Standard InChI | InChI=1S/C16H22O4/c1-2-3-4-5-6-7-14-16-11(9-15(19)20-14)8-12(17)10-13(16)18/h8,10,14,17-18H,2-7,9H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C16H22O4/c1-2-3-4-5-6-7-14-16-11(9-15(19)20-14)8-12(17)10-13(16)18/h8,10,14,17-18H,2-7,9H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 8526 |
| By standard InChI | CHEMBL592967 |
|---|---|
| By standard InChI Main Layer | CHEMBL592967 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P22736 | Nuclear receptor subfamily 4 group A member 1 | Nuclear hormone receptor subfamily 4 group A member 1 | CHEMBL592967 |
CHEMBL1225191
(1)
CHEMBL1227061
(1)
|
0 / 0 |