id | C00003383 |
---|---|
Name | Vermeerin |
CAS RN | 16983-23-6 |
Standard InChI | InChI=1S/C15H20O4/c1-8-4-12-10(9(2)14(17)19-12)6-15(3)7-18-13(16)5-11(8)15/h8,10-12H,2,4-7H2,1,3H3/t8-,10-,11+,12+,15-/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C15H20O4/c1-8-4-12-10(9(2)14(17)19-12)6-15(3)7-18-13(16)5-11(8)15/h8,10-12H,2,4-7H2,1,3H3 |
Phytochemical cluster | No. 38 |
---|---|
KCF-S cluster | No. 2141 |
By standard InChI | CHEMBL573814 |
---|---|
By standard InChI Main Layer | CHEMBL573814 CHEMBL1975417 |
By LinkDB | C09574 |
---|
By CAS RN | C053303 |
---|
family name | count |
---|---|
Asteraceae | 3 |
Rutaceae | 2 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Geijera africana | 1081049 | Rutaceae | rosids | Viridiplantae |
Geijera aspera | 1081049 | Rutaceae | rosids | Viridiplantae |
Hymenoxys anthemoides | 128717 | Asteraceae | asterids | Viridiplantae |
Hymenoxys richardsonii | 128717 | Asteraceae | asterids | Viridiplantae |
Psilostrophe villosa | 41625 | Asteraceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P11511 | Cytochrome P450 19A1 | Cytochrome P450 19A1 | CHEMBL573814 |
CHEMBL1037708
(1)
|
2 / 2 |