| id | C00000340 |
|---|---|
| Name | U-106305 |
| CAS RN | 170591-54-5 |
| Standard InChI | InChI=1S/C28H41NO/c1-15(2)14-29-28(30)7-6-19-10-21(19)23-12-25(23)27-13-26(27)24-11-22(24)20-9-18(20)5-4-17-8-16(17)3/h4-7,15-27H,8-14H2,1-3H3,(H,29,30)/b5-4+,7-6+/t16-,17-,18-,19-,20-,21-,22+,23+,24-,25-,26+,27+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C28H41NO/c1-15(2)14-29-28(30)7-6-19-10-21(19)23-12-25(23)27-13-26(27)24-11-22(24)20-9-18(20)5-4-17-8-16(17)3/h4-7,15-27H,8-14H2,1-3H3,(H,29,30) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7613 |
| By standard InChI | CHEMBL2062153 |
|---|---|
| By standard InChI Main Layer | CHEMBL2062153 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces sp. UC11136 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11597 | Cholesteryl ester transfer protein | Secreted protein | CHEMBL2062153 |
CHEMBL660756
(1)
|
1 / 1 |