| id | C00034027 |
|---|---|
| Name | L-Asparaginate |
| CAS RN | 84061-73-4 |
| Standard InChI | InChI=1S/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H2,6,7)(H,8,9)/p-1/t2-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H2,6,7)(H,8,9) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3843 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL58832 CHEMBL1232369 |
| By LinkDB | C00152 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Brassicaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P49798 | Regulator of G-protein signaling 4 | Unclassified protein | CHEMBL1232369 |
CHEMBL1794499
(1)
|
2 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #604906 | Schizophrenia 9; sczd9 |
P49798
|
| #181500 | Schizophrenia; sczd |
P49798
|