id | C00034060 |
---|---|
Name | Methyltriacetic lactone |
CAS RN | 5192-62-1 |
Standard InChI | InChI=1S/C7H8O3/c1-4-3-6(8)5(2)7(9)10-4/h3,8H,1-2H3 |
Standard InChI (Main Layer) | InChI=1S/C7H8O3/c1-4-3-6(8)5(2)7(9)10-4/h3,8H,1-2H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 3842 |
By standard InChI | CHEMBL51918 |
---|---|
By standard InChI Main Layer | CHEMBL51918 |
By LinkDB |
---|
By CAS RN | C089682 |
---|
class name | count |
---|
family name | count |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Ampelomyces sp. |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P08246 | Neutrophil elastase | S1A | CHEMBL51918 |
CHEMBL675341
(1)
|
2 / 1 |
Q99895 | Chymotrypsin-C | S1A | CHEMBL51918 |
CHEMBL661262
(1)
|
0 / 2 |