| id | C00034327 |
|---|---|
| Name | (E)-Sinapic acid / trans-Sinapic acid / 4-Hydroxy-3,5-dimethoxy-(E)-cinnamic acid |
| CAS RN | 7362-37-0 |
| Standard InChI | InChI=1S/C11H12O5/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14/h3-6,14H,1-2H3,(H,12,13)/b4-3+ |
| Standard InChI (Main Layer) | InChI=1S/C11H12O5/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14/h3-6,14H,1-2H3,(H,12,13) |
| Phytochemical cluster | No. 6 |
|---|---|
| KCF-S cluster | No. 1366 |
| By standard InChI | CHEMBL109341 |
|---|---|
| By standard InChI Main Layer | CHEMBL109341 |
| By LinkDB | C00482 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| family name | count |
|---|---|
| Brassicaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| Wasabia japonica | 75806 | Brassicaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL109341 |
CHEMBL2016146
(1)
|
0 / 3 |
| Q13093 | Platelet-activating factor acetylhydrolase | Enzyme | CHEMBL109341 |
CHEMBL1032505
(1)
|
3 / 0 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL109341 |
CHEMBL2016145
(1)
|
0 / 0 |
| P17405 | Sphingomyelin phosphodiesterase | Enzyme | CHEMBL109341 |
CHEMBL1794495
(1)
|
2 / 2 |
| O94925 | Glutaminase kidney isoform, mitochondrial | Enzyme | CHEMBL109341 |
CHEMBL2114738
(1)
|
0 / 0 |