| id | C00034424 |
|---|---|
| Name | 3-(4'-Geranyloxy-3'-methoxyphenyl)-2-trans propenoic acid |
| CAS RN | 870073-93-1 |
| Standard InChI | InChI=1S/C20H26O4/c1-15(2)6-5-7-16(3)12-13-24-18-10-8-17(9-11-20(21)22)14-19(18)23-4/h6,8-12,14H,5,7,13H2,1-4H3,(H,21,22)/b11-9+,16-12+ |
| Standard InChI (Main Layer) | InChI=1S/C20H26O4/c1-15(2)6-5-7-16(3)12-13-24-18-10-8-17(9-11-20(21)22)14-19(18)23-4/h6,8-12,14H,5,7,13H2,1-4H3,(H,21,22) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3421 |
| By standard InChI | CHEMBL221960 |
|---|---|
| By standard InChI Main Layer | CHEMBL221960 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Acronychia baueri Schott | 43714 | Rutaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q96RI1 | Bile acid receptor | NR1H4 | CHEMBL221960 |
CHEMBL2025894
(1)
CHEMBL2025895
(1)
CHEMBL2025896 (1) CHEMBL2025897 (1) CHEMBL2025898 (1) CHEMBL2025899 (1) CHEMBL2025900 (1) CHEMBL2025901 (1) |
0 / 0 |