| id | C00034466 |
|---|---|
| Name | cis-Miyabenol C / (+)-cis-Miyabenol C |
| CAS RN | 168037-22-7 |
| Standard InChI | InChI=1S/C42H32O9/c43-27-9-2-22(3-10-27)1-4-25-15-32(48)20-35-37(25)40(42(50-35)24-7-13-29(45)14-8-24)34-19-33(49)21-36-39(34)38(26-16-30(46)18-31(47)17-26)41(51-36)23-5-11-28(44)12-6-23/h1-21,38,40-49H/b4-1+/t38-,40+,41+,42-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C42H32O9/c43-27-9-2-22(3-10-27)1-4-25-15-32(48)20-35-37(25)40(42(50-35)24-7-13-29(45)14-8-24)34-19-33(49)21-36-39(34)38(26-16-30(46)18-31(47)17-26)41(51-36)23-5-11-28(44)12-6-23/h1-21,38,40-49H |
| Phytochemical cluster | No. 30 |
|---|---|
| KCF-S cluster | No. 163 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| asterids | 1 |
| family name | count |
|---|---|
| Cyperaceae | 1 |
| Apiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Carex pendula | 312760 | Cyperaceae | Liliopsida | Viridiplantae |
| Foeniculum vulgare | 48038 | Apiaceae | asterids | Viridiplantae |